C17H24FN5O — CID 145238001
2-amino-1-[4-[2-fluoro-4-(4-methyl-2-methylideneimidazolidin-1-yl)phenyl]piperazin-1-yl]ethanone (PubChem CID 145238001) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-amino-1-[4-[2-fluoro-4-(4-methyl-2-methylideneimidazolidin-1-yl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-[2-fluoro-4-(4-methyl-2-methylideneimidazolidin-1-yl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145238001 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-amino-1-[4-[2-fluoro-4-(4-methyl-2-methylideneimidazolidin-1-yl)phenyl]piperazin-1-yl]ethanone |
| SMILES | C=C1NC(C)CN1c1ccc(N2CCN(C(=O)CN)CC2)c(F)c1 |
| InChI | InChI=1S/C17H24FN5O/c1-12-11-23(13(2)20-12)14-3-4-16(15(18)9-14)21-5-7-22(8-6-21)17(24)10-19/h3-4,9,12,20H,2,5-8,10-11,19H2,1H3 |
| InChIKey | LCEZUDKBMWQHAU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|