C19H29F2N7O2S — CID 143096068
O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3,5-difluoroanilino]prop-2-enyl]carbamothioate (PubChem CID 143096068) has the molecular formula C19H29F2N7O2S and a molecular weight of 457.55 g/mol. Its IUPAC name is O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3,5-difluoroanilino]prop-2-enyl]carbamothioate.
| Compound Name | O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3,5-difluoroanilino]prop-2-enyl]carbamothioate |
|---|---|
| PubChem CID | 143096068 |
| Molecular Formula | C19H29F2N7O2S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-[2-(dimethylamino)acetyl]piperazin-1-yl]-3,5-difluoroanilino]prop-2-enyl]carbamothioate |
| SMILES | COC(=S)NC/C(N)=C/N(N)c1cc(F)c(N2CCN(C(=O)CN(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C19H29F2N7O2S/c1-25(2)12-17(29)26-4-6-27(7-5-26)18-15(20)8-14(9-16(18)21)28(23)11-13(22)10-24-19(31)30-3/h8-9,11H,4-7,10,12,22-23H2,1-3H3,(H,24,31)/b13-11- |
| InChIKey | DFEKJAGZZFEDFF-QBFSEMIESA-N |
| XLogP | 0.18 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|