C19H29F2N5O4S — CID 143096299
O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)anilino]prop-2-enyl]carbamothioate;propane-1,2-diol (PubChem CID 143096299) has the molecular formula C19H29F2N5O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)anilino]prop-2-enyl]carbamothioate;propane-1,2-diol.
| Compound Name | O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)anilino]prop-2-enyl]carbamothioate;propane-1,2-diol |
|---|---|
| PubChem CID | 143096299 |
| Molecular Formula | C19H29F2N5O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)anilino]prop-2-enyl]carbamothioate;propane-1,2-diol |
| SMILES | CC(O)CO.COC(=S)NC/C(N)=C/Nc1cc(F)c(N2CCN(C=O)CC2)c(F)c1 |
| InChI | InChI=1S/C16H21F2N5O2S.C3H8O2/c1-25-16(26)21-9-11(19)8-20-12-6-13(17)15(14(18)7-12)23-4-2-22(10-24)3-5-23;1-3(5)2-4/h6-8,10,20H,2-5,9,19H2,1H3,(H,21,26);3-5H,2H2,1H3/b11-8-; |
| InChIKey | QRBOGSSZVTZIGK-MKFZHGHUSA-N |
| XLogP | 0.34 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|