C22H35F2N7O3S — CID 143096407
methanol;O-methyl N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]anilino]prop-2-enyl]carbamothioate (PubChem CID 143096407) has the molecular formula C22H35F2N7O3S and a molecular weight of 515.63 g/mol. Its IUPAC name is methanol;O-methyl N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]anilino]prop-2-enyl]carbamothioate.
| Compound Name | methanol;O-methyl N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]anilino]prop-2-enyl]carbamothioate |
|---|---|
| PubChem CID | 143096407 |
| Molecular Formula | C22H35F2N7O3S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | methanol;O-methyl N-[(Z)-2-amino-3-[N-amino-3,5-difluoro-4-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]anilino]prop-2-enyl]carbamothioate |
| SMILES | CO.COC(=S)NC/C(N)=C/N(N)c1cc(F)c(N2CCN(C(=O)CN3CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H31F2N7O2S.CH4O/c1-32-21(33)26-12-15(24)13-30(25)16-10-17(22)20(18(23)11-16)29-8-6-28(7-9-29)19(31)14-27-4-2-3-5-27;1-2/h10-11,13H,2-9,12,14,24-25H2,1H3,(H,26,33);2H,1H3/b15-13-; |
| InChIKey | PKIURQNGLQUQMA-ZDCVYKBASA-N |
| XLogP | 0.32 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|