C19H28F2N6O3 — CID 143096222
[4-[4-[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]-2,6-difluorophenyl]piperazin-1-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone (PubChem CID 143096222) has the molecular formula C19H28F2N6O3 and a molecular weight of 426.47 g/mol. Its IUPAC name is [4-[4-[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]-2,6-difluorophenyl]piperazin-1-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone.
| Compound Name | [4-[4-[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]-2,6-difluorophenyl]piperazin-1-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone |
|---|---|
| PubChem CID | 143096222 |
| Molecular Formula | C19H28F2N6O3 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [4-[4-[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]-2,6-difluorophenyl]piperazin-1-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone |
| SMILES | CC1(C)OCC(C(=O)N2CCN(c3c(F)cc(N(N)/C=C(\N)CN)cc3F)CC2)O1 |
| InChI | InChI=1S/C19H28F2N6O3/c1-19(2)29-11-16(30-19)18(28)26-5-3-25(4-6-26)17-14(20)7-13(8-15(17)21)27(24)10-12(23)9-22/h7-8,10,16H,3-6,9,11,22-24H2,1-2H3/b12-10- |
| InChIKey | CKTLWZVGYPDCPT-BENRWUELSA-N |
| XLogP | 0.20 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|