C18H27FN6O4S — CID 143096274
O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-(2,3-dihydroxypropanoyl)piperazin-1-yl]-3-fluoroanilino]prop-2-enyl]carbamothioate (PubChem CID 143096274) has the molecular formula C18H27FN6O4S and a molecular weight of 442.52 g/mol. Its IUPAC name is O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-(2,3-dihydroxypropanoyl)piperazin-1-yl]-3-fluoroanilino]prop-2-enyl]carbamothioate.
| Compound Name | O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-(2,3-dihydroxypropanoyl)piperazin-1-yl]-3-fluoroanilino]prop-2-enyl]carbamothioate |
|---|---|
| PubChem CID | 143096274 |
| Molecular Formula | C18H27FN6O4S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | O-methyl N-[(Z)-2-amino-3-[N-amino-4-[4-(2,3-dihydroxypropanoyl)piperazin-1-yl]-3-fluoroanilino]prop-2-enyl]carbamothioate |
| SMILES | COC(=S)NC/C(N)=C/N(N)c1ccc(N2CCN(C(=O)C(O)CO)CC2)c(F)c1 |
| InChI | InChI=1S/C18H27FN6O4S/c1-29-18(30)22-9-12(20)10-25(21)13-2-3-15(14(19)8-13)23-4-6-24(7-5-23)17(28)16(27)11-26/h2-3,8,10,16,26-27H,4-7,9,11,20-21H2,1H3,(H,22,30)/b12-10- |
| InChIKey | ADPDZIVLNGEZHN-BENRWUELSA-N |
| XLogP | -1.17 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|