C17H27FN6O3S — CID 143030727
N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-[4-(hydroxymethyl)-3-oxopiperazin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane (PubChem CID 143030727) has the molecular formula C17H27FN6O3S and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-[4-(hydroxymethyl)-3-oxopiperazin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane.
| Compound Name | N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-[4-(hydroxymethyl)-3-oxopiperazin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane |
|---|---|
| PubChem CID | 143030727 |
| Molecular Formula | C17H27FN6O3S |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-[4-(hydroxymethyl)-3-oxopiperazin-1-yl]anilino]prop-2-enyl]methanethioamide;methoxymethane |
| SMILES | COC.N/C(=C\N(N)c1ccc(N2CCN(CO)C(=O)C2)c(F)c1)CNC=S |
| InChI | InChI=1S/C15H21FN6O2S.C2H6O/c16-13-5-12(22(18)7-11(17)6-19-9-25)1-2-14(13)20-3-4-21(10-23)15(24)8-20;1-3-2/h1-2,5,7,9,23H,3-4,6,8,10,17-18H2,(H,19,25);1-2H3/b11-7-; |
| InChIKey | VKNQYCKZNJNZLZ-AJULUCINSA-N |
| XLogP | -0.29 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|