C18H26FN5O4 — CID 143030717
tert-butyl 4-[4-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]-2-fluorophenyl]-2-oxopiperazine-1-carboxylate (PubChem CID 143030717) has the molecular formula C18H26FN5O4 and a molecular weight of 395.44 g/mol. Its IUPAC name is tert-butyl 4-[4-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]-2-fluorophenyl]-2-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]-2-fluorophenyl]-2-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 143030717 |
| Molecular Formula | C18H26FN5O4 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl 4-[4-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]-2-fluorophenyl]-2-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N(N)/C=C(\N)CO)cc2F)CC1=O |
| InChI | InChI=1S/C18H26FN5O4/c1-18(2,3)28-17(27)23-7-6-22(10-16(23)26)15-5-4-13(8-14(15)19)24(21)9-12(20)11-25/h4-5,8-9,25H,6-7,10-11,20-21H2,1-3H3/b12-9- |
| InChIKey | MMVSGXWVIBZPIM-XFXZXTDPSA-N |
| XLogP | 0.88 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|