C14H18FN3O3 — CID 143030755
tert-butyl 3-(4-amino-2-fluorophenyl)-5-oxoimidazolidine-1-carboxylate (PubChem CID 143030755) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is tert-butyl 3-(4-amino-2-fluorophenyl)-5-oxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-amino-2-fluorophenyl)-5-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 143030755 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | tert-butyl 3-(4-amino-2-fluorophenyl)-5-oxoimidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CN(c2ccc(N)cc2F)CC1=O |
| InChI | InChI=1S/C14H18FN3O3/c1-14(2,3)21-13(20)18-8-17(7-12(18)19)11-5-4-9(16)6-10(11)15/h4-6H,7-8,16H2,1-3H3 |
| InChIKey | VGGIUVCDKNRRGU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|