C22H34FN3O4 — CID 156506108
tert-butyl 2-[1-(4-amino-2-fluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]acetate (PubChem CID 156506108) has the molecular formula C22H34FN3O4 and a molecular weight of 423.53 g/mol. Its IUPAC name is tert-butyl 2-[1-(4-amino-2-fluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-(4-amino-2-fluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156506108 |
| Molecular Formula | C22H34FN3O4 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | tert-butyl 2-[1-(4-amino-2-fluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(NC(=O)OC(C)(C)C)CCN(c2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C22H34FN3O4/c1-20(2,3)29-18(27)14-22(25-19(28)30-21(4,5)6)9-11-26(12-10-22)17-8-7-15(24)13-16(17)23/h7-8,13H,9-12,14,24H2,1-6H3,(H,25,28) |
| InChIKey | XOGXHYRMSHOLET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|