C21H30F3N3O2 — CID 164720679
tert-butyl (4S)-4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 164720679) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is tert-butyl (4S)-4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164720679 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | tert-butyl (4S)-4-[1-(4-amino-2-fluorophenyl)piperidin-4-yl]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C2CCN(c3ccc(N)cc3F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C21H30F3N3O2/c1-20(2,3)29-19(28)27-11-8-16(21(23,24)13-27)14-6-9-26(10-7-14)18-5-4-15(25)12-17(18)22/h4-5,12,14,16H,6-11,13,25H2,1-3H3/t16-/m0/s1 |
| InChIKey | KISVEXKIZXMUNL-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|