C14H18N2O3 — CID 91825826
tert-butyl 6-amino-2-oxo-3,4-dihydroquinoline-1-carboxylate (PubChem CID 91825826) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl 6-amino-2-oxo-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | tert-butyl 6-amino-2-oxo-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 91825826 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | tert-butyl 6-amino-2-oxo-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)19-13(18)16-11-6-5-10(15)8-9(11)4-7-12(16)17/h5-6,8H,4,7,15H2,1-3H3 |
| InChIKey | INYFPTXHNMNUJN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|