C13H15NO4 — CID 155928671
tert-butyl 5-hydroxy-2-oxo-3H-indole-1-carboxylate (PubChem CID 155928671) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 155928671 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | tert-butyl 5-hydroxy-2-oxo-3H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)Cc2cc(O)ccc21 |
| InChI | InChI=1S/C13H15NO4/c1-13(2,3)18-12(17)14-10-5-4-9(15)6-8(10)7-11(14)16/h4-6,15H,7H2,1-3H3 |
| InChIKey | LLRXCNHBNUEENT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |