C16H23FN6O2S — CID 143030674
O-ethyl N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-(3-oxopiperazin-1-yl)anilino]prop-2-enyl]carbamothioate (PubChem CID 143030674) has the molecular formula C16H23FN6O2S and a molecular weight of 382.47 g/mol. Its IUPAC name is O-ethyl N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-(3-oxopiperazin-1-yl)anilino]prop-2-enyl]carbamothioate.
| Compound Name | O-ethyl N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-(3-oxopiperazin-1-yl)anilino]prop-2-enyl]carbamothioate |
|---|---|
| PubChem CID | 143030674 |
| Molecular Formula | C16H23FN6O2S |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | O-ethyl N-[(Z)-2-amino-3-[N-amino-3-fluoro-4-(3-oxopiperazin-1-yl)anilino]prop-2-enyl]carbamothioate |
| SMILES | CCOC(=S)NC/C(N)=C/N(N)c1ccc(N2CCNC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C16H23FN6O2S/c1-2-25-16(26)21-8-11(18)9-23(19)12-3-4-14(13(17)7-12)22-6-5-20-15(24)10-22/h3-4,7,9H,2,5-6,8,10,18-19H2,1H3,(H,20,24)(H,21,26)/b11-9- |
| InChIKey | UZGFUJLGAUYGMB-LUAWRHEFSA-N |
| XLogP | 0.15 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|