C26H34FN3O6 — CID 54399053
tert-butyl 4-[4-[2,3-dihydroxypropyl(phenylmethoxycarbonyl)amino]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 54399053) has the molecular formula C26H34FN3O6 and a molecular weight of 503.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[2,3-dihydroxypropyl(phenylmethoxycarbonyl)amino]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2,3-dihydroxypropyl(phenylmethoxycarbonyl)amino]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54399053 |
| Molecular Formula | C26H34FN3O6 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | tert-butyl 4-[4-[2,3-dihydroxypropyl(phenylmethoxycarbonyl)amino]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N(CC(O)CO)C(=O)OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C26H34FN3O6/c1-26(2,3)36-24(33)29-13-11-28(12-14-29)23-10-9-20(15-22(23)27)30(16-21(32)17-31)25(34)35-18-19-7-5-4-6-8-19/h4-10,15,21,31-32H,11-14,16-18H2,1-3H3 |
| InChIKey | VMCGKCFQVCDTME-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|