C21H33FN2O5 — CID 66700385
tert-butyl N-(2,2-diethoxyethyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate (PubChem CID 66700385) has the molecular formula C21H33FN2O5 and a molecular weight of 412.50 g/mol. Its IUPAC name is tert-butyl N-(2,2-diethoxyethyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate.
| Compound Name | tert-butyl N-(2,2-diethoxyethyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
|---|---|
| PubChem CID | 66700385 |
| Molecular Formula | C21H33FN2O5 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl N-(2,2-diethoxyethyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
| SMILES | CCOC(CN(C(=O)OC(C)(C)C)c1ccc(N2CCOCC2)c(F)c1)OCC |
| InChI | InChI=1S/C21H33FN2O5/c1-6-27-19(28-7-2)15-24(20(25)29-21(3,4)5)16-8-9-18(17(22)14-16)23-10-12-26-13-11-23/h8-9,14,19H,6-7,10-13,15H2,1-5H3 |
| InChIKey | MTXYKFAZIVZFBO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|