C21H25FN2O5 — CID 11961359
benzyl N-[(2S)-2,3-dihydroxypropyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate (PubChem CID 11961359) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is benzyl N-[(2S)-2,3-dihydroxypropyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate.
| Compound Name | benzyl N-[(2S)-2,3-dihydroxypropyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
|---|---|
| PubChem CID | 11961359 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | benzyl N-[(2S)-2,3-dihydroxypropyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
| SMILES | O=C(OCc1ccccc1)N(C[C@H](O)CO)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C21H25FN2O5/c22-19-12-17(6-7-20(19)23-8-10-28-11-9-23)24(13-18(26)14-25)21(27)29-15-16-4-2-1-3-5-16/h1-7,12,18,25-26H,8-11,13-15H2/t18-/m0/s1 |
| InChIKey | YIPHQEJFYOFTNZ-SFHVURJKSA-N |
| XLogP | 2.16 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|