C33H40FN3O3 — CID 70334634
benzyl N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate (PubChem CID 70334634) has the molecular formula C33H40FN3O3 and a molecular weight of 545.70 g/mol. Its IUPAC name is benzyl N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate.
| Compound Name | benzyl N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
|---|---|
| PubChem CID | 70334634 |
| Molecular Formula | C33H40FN3O3 |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | benzyl N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate |
| SMILES | CCc1ccc(CN2CCC(CN(C(=O)OCc3ccccc3)c3ccc(N4CCOCC4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C33H40FN3O3/c1-2-26-8-10-27(11-9-26)23-35-16-14-28(15-17-35)24-37(33(38)40-25-29-6-4-3-5-7-29)30-12-13-32(31(34)22-30)36-18-20-39-21-19-36/h3-13,22,28H,2,14-21,23-25H2,1H3 |
| InChIKey | VRFXLVASKYLPND-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|