C20H26FNO3 — CID 142383850
ethylbenzene;3-fluoro-4-morpholin-4-ylbenzaldehyde;methanol (PubChem CID 142383850) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is ethylbenzene;3-fluoro-4-morpholin-4-ylbenzaldehyde;methanol.
| Compound Name | ethylbenzene;3-fluoro-4-morpholin-4-ylbenzaldehyde;methanol |
|---|---|
| PubChem CID | 142383850 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethylbenzene;3-fluoro-4-morpholin-4-ylbenzaldehyde;methanol |
| SMILES | CCc1ccccc1.CO.O=Cc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C11H12FNO2.C8H10.CH4O/c12-10-7-9(8-14)1-2-11(10)13-3-5-15-6-4-13;1-2-8-6-4-3-5-7-8;1-2/h1-2,7-8H,3-6H2;3-7H,2H2,1H3;2H,1H3 |
| InChIKey | WYOGLKQCZIBNJL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|