C20H22FNO3 — CID 145192081
benzyl 3-(3-fluoro-4-morpholin-4-ylphenyl)propanoate (PubChem CID 145192081) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is benzyl 3-(3-fluoro-4-morpholin-4-ylphenyl)propanoate.
| Compound Name | benzyl 3-(3-fluoro-4-morpholin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 145192081 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | benzyl 3-(3-fluoro-4-morpholin-4-ylphenyl)propanoate |
| SMILES | O=C(CCc1ccc(N2CCOCC2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H22FNO3/c21-18-14-16(6-8-19(18)22-10-12-24-13-11-22)7-9-20(23)25-15-17-4-2-1-3-5-17/h1-6,8,14H,7,9-13,15H2 |
| InChIKey | LGSIUNTWOBFJHN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |