C30H32Cl2FN3O2 — CID 11671255
N,1-bis[(4-chlorophenyl)methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)piperidine-4-carboxamide (PubChem CID 11671255) has the molecular formula C30H32Cl2FN3O2 and a molecular weight of 556.51 g/mol. Its IUPAC name is N,1-bis[(4-chlorophenyl)methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)piperidine-4-carboxamide.
| Compound Name | N,1-bis[(4-chlorophenyl)methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 11671255 |
| Molecular Formula | C30H32Cl2FN3O2 |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N,1-bis[(4-chlorophenyl)methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
| SMILES | O=C(C1CCN(Cc2ccc(Cl)cc2)CC1)N(Cc1ccc(Cl)cc1)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C30H32Cl2FN3O2/c31-25-5-1-22(2-6-25)20-34-13-11-24(12-14-34)30(37)36(21-23-3-7-26(32)8-4-23)27-9-10-29(28(33)19-27)35-15-17-38-18-16-35/h1-10,19,24H,11-18,20-21H2 |
| InChIKey | BJITVHMUTORODG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|