C30H42FN3O2 — CID 11691757
N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)pentanamide (PubChem CID 11691757) has the molecular formula C30H42FN3O2 and a molecular weight of 495.68 g/mol. Its IUPAC name is N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)pentanamide.
| Compound Name | N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 11691757 |
| Molecular Formula | C30H42FN3O2 |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | N-[[1-[(4-ethylphenyl)methyl]piperidin-4-yl]methyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)pentanamide |
| SMILES | CCCCC(=O)N(CC1CCN(Cc2ccc(CC)cc2)CC1)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C30H42FN3O2/c1-3-5-6-30(35)34(27-11-12-29(28(31)21-27)33-17-19-36-20-18-33)23-26-13-15-32(16-14-26)22-25-9-7-24(4-2)8-10-25/h7-12,21,26H,3-6,13-20,22-23H2,1-2H3 |
| InChIKey | BSMWZOHHBDDQJB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|