C34H49N3O3 — CID 11635312
N-[[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl]-N-(4-morpholin-4-ylphenyl)-2-(oxan-4-yl)acetamide (PubChem CID 11635312) has the molecular formula C34H49N3O3 and a molecular weight of 547.78 g/mol. Its IUPAC name is N-[[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl]-N-(4-morpholin-4-ylphenyl)-2-(oxan-4-yl)acetamide.
| Compound Name | N-[[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl]-N-(4-morpholin-4-ylphenyl)-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 11635312 |
| Molecular Formula | C34H49N3O3 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.38 |
| IUPAC Name | N-[[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl]-N-(4-morpholin-4-ylphenyl)-2-(oxan-4-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(CN2CCC(CN(C(=O)CC3CCOCC3)c3ccc(N4CCOCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H49N3O3/c1-34(2,3)30-6-4-28(5-7-30)25-35-16-12-29(13-17-35)26-37(33(38)24-27-14-20-39-21-15-27)32-10-8-31(9-11-32)36-18-22-40-23-19-36/h4-11,27,29H,12-26H2,1-3H3 |
| InChIKey | INJVLGLAOPXVBP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|