C32H49N5O3 — CID 129267596
[[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl-(6-morpholin-4-yl-3-pyridinyl)amino]-(oxan-4-ylamino)methanol (PubChem CID 129267596) has the molecular formula C32H49N5O3 and a molecular weight of 551.78 g/mol. Its IUPAC name is [[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl-(6-morpholin-4-yl-3-pyridinyl)amino]-(oxan-4-ylamino)methanol.
| Compound Name | [[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl-(6-morpholin-4-yl-3-pyridinyl)amino]-(oxan-4-ylamino)methanol |
|---|---|
| PubChem CID | 129267596 |
| Molecular Formula | C32H49N5O3 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | [[1-[(4-tert-butylphenyl)methyl]piperidin-4-yl]methyl-(6-morpholin-4-yl-3-pyridinyl)amino]-(oxan-4-ylamino)methanol |
| SMILES | CC(C)(C)c1ccc(CN2CCC(CN(c3ccc(N4CCOCC4)nc3)C(O)NC3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C32H49N5O3/c1-32(2,3)27-6-4-25(5-7-27)23-35-14-10-26(11-15-35)24-37(31(38)34-28-12-18-39-19-13-28)29-8-9-30(33-22-29)36-16-20-40-21-17-36/h4-9,22,26,28,31,34,38H,10-21,23-24H2,1-3H3 |
| InChIKey | GJWATLQHJXWWDA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|