C25H35N3O2 — CID 30312063
1-[(4-tert-butylphenyl)methyl]-1-methyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea (PubChem CID 30312063) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-1-methyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-1-methyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 30312063 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-1-methyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)C(=O)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H35N3O2/c1-25(2,3)23-11-9-21(10-12-23)18-27(4)24(29)26-17-20-5-7-22(8-6-20)19-28-13-15-30-16-14-28/h5-12H,13-19H2,1-4H3,(H,26,29) |
| InChIKey | QETALIMGBIVZRH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |