C24H32N4O3 — CID 56512786
3-[[benzyl(methyl)carbamoyl]amino]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]propanamide (PubChem CID 56512786) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 56512786 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)NCCC(=O)NCc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C24H32N4O3/c1-27(18-20-6-3-2-4-7-20)24(30)25-11-10-23(29)26-17-21-8-5-9-22(16-21)19-28-12-14-31-15-13-28/h2-9,16H,10-15,17-19H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | FNIAWAFNNOFVGG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |