C22H30FIN4O — CID 111307469
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111307469) has the molecular formula C22H30FIN4O and a molecular weight of 512.41 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307469 |
| Molecular Formula | C22H30FIN4O |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CN2CCOCC2)cc1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H29FN4O.HI/c1-24-22(26(2)16-19-7-9-21(23)10-8-19)25-15-18-3-5-20(6-4-18)17-27-11-13-28-14-12-27;/h3-10H,11-17H2,1-2H3,(H,24,25);1H |
| InChIKey | HIVLOCOBEWIMCG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|