C15H19FIN3S — CID 111307187
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111307187) has the molecular formula C15H19FIN3S and a molecular weight of 419.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307187 |
| Molecular Formula | C15H19FIN3S |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccsc1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C15H18FN3S.HI/c1-17-15(18-9-13-7-8-20-11-13)19(2)10-12-3-5-14(16)6-4-12;/h3-8,11H,9-10H2,1-2H3,(H,17,18);1H |
| InChIKey | LORLSLNTGOKUFP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|