C15H26FIN4 — CID 111306512
3-[2-[ethyl(methyl)amino]ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111306512) has the molecular formula C15H26FIN4 and a molecular weight of 408.30 g/mol. Its IUPAC name is 3-[2-[ethyl(methyl)amino]ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-[ethyl(methyl)amino]ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111306512 |
| Molecular Formula | C15H26FIN4 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3-[2-[ethyl(methyl)amino]ethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN(C)CCN/C(=N\C)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C15H25FN4.HI/c1-5-19(3)11-10-18-15(17-2)20(4)12-13-6-8-14(16)9-7-13;/h6-9H,5,10-12H2,1-4H3,(H,17,18);1H |
| InChIKey | PIPBZDVNNMMXSC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|