C17H24IN3OS — CID 111275088
1-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111275088) has the molecular formula C17H24IN3OS and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111275088 |
| Molecular Formula | C17H24IN3OS |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOc1ccc(CN(C)/C(=N/C)NCc2ccsc2)cc1.I |
| InChI | InChI=1S/C17H23N3OS.HI/c1-4-21-16-7-5-14(6-8-16)12-20(3)17(18-2)19-11-15-9-10-22-13-15;/h5-10,13H,4,11-12H2,1-3H3,(H,18,19);1H |
| InChIKey | DIHHSEPVUQHHTR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|