C24H38N2O2 — CID 110353819
4-(4-tert-butylphenyl)-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one (PubChem CID 110353819) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenyl)-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110353819 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(CCCC(=O)N2CCC(CN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C24H38N2O2/c1-24(2,3)22-9-7-20(8-10-22)5-4-6-23(27)26-13-11-21(12-14-26)19-25-15-17-28-18-16-25/h7-10,21H,4-6,11-19H2,1-3H3 |
| InChIKey | DSKNVZQPYLEKMY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |