C20H33ClN2O — CID 119484639
1-[3-(aminomethyl)pyrrolidin-1-yl]-5-(4-tert-butylphenyl)pentan-1-one;hydrochloride (PubChem CID 119484639) has the molecular formula C20H33ClN2O and a molecular weight of 352.95 g/mol. Its IUPAC name is 1-[3-(aminomethyl)pyrrolidin-1-yl]-5-(4-tert-butylphenyl)pentan-1-one;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-5-(4-tert-butylphenyl)pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119484639 |
| Molecular Formula | C20H33ClN2O |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-5-(4-tert-butylphenyl)pentan-1-one;hydrochloride |
| SMILES | CC(C)(C)c1ccc(CCCCC(=O)N2CCC(CN)C2)cc1.Cl |
| InChI | InChI=1S/C20H32N2O.ClH/c1-20(2,3)18-10-8-16(9-11-18)6-4-5-7-19(23)22-13-12-17(14-21)15-22;/h8-11,17H,4-7,12-15,21H2,1-3H3;1H |
| InChIKey | DYULLTUZKJMFIH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|