C16H24ClIN2O — CID 119410112
1-[(3R)-3-aminopyrrolidin-1-yl]-6-(4-iodophenyl)hexan-1-one;hydrochloride (PubChem CID 119410112) has the molecular formula C16H24ClIN2O and a molecular weight of 422.74 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-6-(4-iodophenyl)hexan-1-one;hydrochloride.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-6-(4-iodophenyl)hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119410112 |
| Molecular Formula | C16H24ClIN2O |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-6-(4-iodophenyl)hexan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)CCCCCc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C16H23IN2O.ClH/c17-14-8-6-13(7-9-14)4-2-1-3-5-16(20)19-11-10-15(18)12-19;/h6-9,15H,1-5,10-12,18H2;1H/t15-;/m1./s1 |
| InChIKey | MFYCYDSHKBXMJT-XFULWGLBSA-N |
| XLogP | 3.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|