C17H26FN3O3 — CID 171659194
N-[2-[ethoxymethyl(methyl)amino]ethyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)formamide (PubChem CID 171659194) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is N-[2-[ethoxymethyl(methyl)amino]ethyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)formamide.
| Compound Name | N-[2-[ethoxymethyl(methyl)amino]ethyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)formamide |
|---|---|
| PubChem CID | 171659194 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-[2-[ethoxymethyl(methyl)amino]ethyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)formamide |
| SMILES | CCOCN(C)CCN(C=O)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O3/c1-3-23-14-19(2)6-7-21(13-22)15-4-5-17(16(18)12-15)20-8-10-24-11-9-20/h4-5,12-13H,3,6-11,14H2,1-2H3 |
| InChIKey | IGCMWBRZHSGMOQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|