C14H16ClF3N2O2 — CID 91677749
N-(3-chloro-4-morpholin-4-ylphenyl)-N-ethyl-2,2,2-trifluoroacetamide (PubChem CID 91677749) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-N-ethyl-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-N-ethyl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91677749 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-N-ethyl-2,2,2-trifluoroacetamide |
| SMILES | CCN(C(=O)C(F)(F)F)c1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-2-20(13(21)14(16,17)18)10-3-4-12(11(15)9-10)19-5-7-22-8-6-19/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | XKGZAUNEQFQPSY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|