C23H29N3O3 — CID 108968361
N-ethyl-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)-N-phenylpropanediamide (PubChem CID 108968361) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)-N-phenylpropanediamide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)-N-phenylpropanediamide |
|---|---|
| PubChem CID | 108968361 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)-N-phenylpropanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)Nc1ccccc1N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O3/c1-4-26(18-10-6-5-7-11-18)22(28)23(2,3)21(27)24-19-12-8-9-13-20(19)25-14-16-29-17-15-25/h5-13H,4,14-17H2,1-3H3,(H,24,27) |
| InChIKey | JWRGJTOVJJLKFM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|