C22H24N4O3 — CID 108969937
N-(4-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)propanediamide (PubChem CID 108969937) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)propanediamide.
| Compound Name | N-(4-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108969937 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-(4-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylphenyl)propanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C#N)cc1)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C22H24N4O3/c1-22(2,20(27)24-17-9-7-16(15-23)8-10-17)21(28)25-18-5-3-4-6-19(18)26-11-13-29-14-12-26/h3-10H,11-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | VHKYQMIOQXXABE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|