C21H24N4O2 — CID 17494196
N-(4-cyanophenyl)-2-[methyl-[(2-morpholin-4-ylphenyl)methyl]amino]acetamide (PubChem CID 17494196) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[methyl-[(2-morpholin-4-ylphenyl)methyl]amino]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[methyl-[(2-morpholin-4-ylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 17494196 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-(4-cyanophenyl)-2-[methyl-[(2-morpholin-4-ylphenyl)methyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(C#N)cc1)Cc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C21H24N4O2/c1-24(16-21(26)23-19-8-6-17(14-22)7-9-19)15-18-4-2-3-5-20(18)25-10-12-27-13-11-25/h2-9H,10-13,15-16H2,1H3,(H,23,26) |
| InChIKey | CHJZSUSVTWJWMC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |