C21H31N3O3 — CID 108966794
2,2-dimethyl-3-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)-3-oxopropanamide (PubChem CID 108966794) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)-3-oxopropanamide.
| Compound Name | 2,2-dimethyl-3-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108966794 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2,2-dimethyl-3-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)-3-oxopropanamide |
| SMILES | CC1CCCN(C(=O)C(C)(C)C(=O)Nc2ccccc2N2CCOCC2)C1 |
| InChI | InChI=1S/C21H31N3O3/c1-16-7-6-10-24(15-16)20(26)21(2,3)19(25)22-17-8-4-5-9-18(17)23-11-13-27-14-12-23/h4-5,8-9,16H,6-7,10-15H2,1-3H3,(H,22,25) |
| InChIKey | NAGGFAPCNGGRKD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|