C20H28N2O2 — CID 108966814
2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione (PubChem CID 108966814) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione.
| Compound Name | 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108966814 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
| SMILES | CC1CCCN(C(=O)C(C)(C)C(=O)N2c3ccccc3CC2C)C1 |
| InChI | InChI=1S/C20H28N2O2/c1-14-8-7-11-21(13-14)18(23)20(3,4)19(24)22-15(2)12-16-9-5-6-10-17(16)22/h5-6,9-10,14-15H,7-8,11-13H2,1-4H3 |
| InChIKey | PJOYWAVXBZKFAI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|