C22H33N3O2 — CID 108964806
1-(4-benzylpiperazin-1-yl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)propane-1,3-dione (PubChem CID 108964806) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)propane-1,3-dione.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108964806 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
| SMILES | CC1CCCN(C(=O)C(C)(C)C(=O)N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-18-8-7-11-25(16-18)21(27)22(2,3)20(26)24-14-12-23(13-15-24)17-19-9-5-4-6-10-19/h4-6,9-10,18H,7-8,11-17H2,1-3H3 |
| InChIKey | UUWMNLLGNIJQDA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|