C23H28N4O2 — CID 108965609
2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propane-1,3-dione (PubChem CID 108965609) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108965609 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2,2-dimethyl-1-(2-methyl-2,3-dihydroindol-1-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propane-1,3-dione |
| SMILES | CC1Cc2ccccc2N1C(=O)C(C)(C)C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-17-16-18-8-4-5-9-19(18)27(17)22(29)23(2,3)21(28)26-14-12-25(13-15-26)20-10-6-7-11-24-20/h4-11,17H,12-16H2,1-3H3 |
| InChIKey | VUNJZBLVTFRMDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|