C24H30N2O2 — CID 108966235
N-benzyl-2,2-dimethyl-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxo-N-propan-2-ylpropanamide (PubChem CID 108966235) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxo-N-propan-2-ylpropanamide.
| Compound Name | N-benzyl-2,2-dimethyl-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxo-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 108966235 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-benzyl-2,2-dimethyl-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxo-N-propan-2-ylpropanamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C(=O)N1c2ccccc2CC1C |
| InChI | InChI=1S/C24H30N2O2/c1-17(2)25(16-19-11-7-6-8-12-19)22(27)24(4,5)23(28)26-18(3)15-20-13-9-10-14-21(20)26/h6-14,17-18H,15-16H2,1-5H3 |
| InChIKey | MWESGSQNFCUMND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|