About N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide
N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide (PubChem CID 108947398) has the molecular formula C22H27N3O3
and a molecular weight of 381.48 g/mol. Its IUPAC name is N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide.
Molecular Properties
| Compound Name | N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide |
| PubChem CID | 108947398 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CC(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-24(17-18-8-4-3-5-9-18)22(27)16-21(26)23-19-10-6-7-11-20(19)25-12-14-28-15-13-25/h3-11H,2,12-17H2,1H3,(H,23,26) |
| InChIKey | OOEAVKKSJFDBFU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide?
The IUPAC name of N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide (CID 108947398) is N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide.
What is the SMILES notation for N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide?
The canonical SMILES for N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide is CCN(Cc1ccccc1)C(=O)CC(=O)Nc1ccccc1N1CCOCC1.
What is the InChIKey of N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide?
The InChIKey is OOEAVKKSJFDBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O3/c1-2-24(17-18-8-4-3-5-9-18)22(27)16-21(26)23-19-10-6-7-11-20(19)25-12-14-28-15-13-25/h3-11H,2,12-17H2,1H3,(H,23,26).
What are the key properties of N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide?
N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide has a molecular weight of 381.48 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-ethyl-N-(2-morpholin-4-ylphenyl)propanediamide is sourced from PubChem (CID 108947398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).