C21H26N4O3 — CID 108948987
N'-methyl-N-(2-morpholin-4-ylphenyl)-N'-(2-pyridin-4-ylethyl)propanediamide (PubChem CID 108948987) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-ylphenyl)-N'-(2-pyridin-4-ylethyl)propanediamide.
| Compound Name | N'-methyl-N-(2-morpholin-4-ylphenyl)-N'-(2-pyridin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108948987 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-ylphenyl)-N'-(2-pyridin-4-ylethyl)propanediamide |
| SMILES | CN(CCc1ccncc1)C(=O)CC(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C21H26N4O3/c1-24(11-8-17-6-9-22-10-7-17)21(27)16-20(26)23-18-4-2-3-5-19(18)25-12-14-28-15-13-25/h2-7,9-10H,8,11-16H2,1H3,(H,23,26) |
| InChIKey | JECVLIMVTGIFGB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|