C20H23N3O4 — CID 108949017
ethyl 2-[[3-[methyl(2-pyridin-4-ylethyl)amino]-3-oxopropanoyl]amino]benzoate (PubChem CID 108949017) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 2-[[3-[methyl(2-pyridin-4-ylethyl)amino]-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-[methyl(2-pyridin-4-ylethyl)amino]-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108949017 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | ethyl 2-[[3-[methyl(2-pyridin-4-ylethyl)amino]-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CC(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-27-20(26)16-6-4-5-7-17(16)22-18(24)14-19(25)23(2)13-10-15-8-11-21-12-9-15/h4-9,11-12H,3,10,13-14H2,1-2H3,(H,22,24) |
| InChIKey | BGBQWYPBGTVFTE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|