C23H26F2N6O4S — CID 143096362
O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]anilino]prop-2-enyl]carbamothioate (PubChem CID 143096362) has the molecular formula C23H26F2N6O4S and a molecular weight of 520.56 g/mol. Its IUPAC name is O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]anilino]prop-2-enyl]carbamothioate.
| Compound Name | O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]anilino]prop-2-enyl]carbamothioate |
|---|---|
| PubChem CID | 143096362 |
| Molecular Formula | C23H26F2N6O4S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | O-methyl N-[(Z)-2-amino-3-[3,5-difluoro-4-[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]anilino]prop-2-enyl]carbamothioate |
| SMILES | COC(=S)NC/C(N)=C/Nc1cc(F)c(N2CCN(C(=O)Cc3cccc([N+](=O)[O-])c3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H26F2N6O4S/c1-35-23(36)28-14-16(26)13-27-17-11-19(24)22(20(25)12-17)30-7-5-29(6-8-30)21(32)10-15-3-2-4-18(9-15)31(33)34/h2-4,9,11-13,27H,5-8,10,14,26H2,1H3,(H,28,36)/b16-13- |
| InChIKey | GMKPUPJIWFLVQF-SSZFMOIBSA-N |
| XLogP | 2.50 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|