C23H25F2N7O2S — CID 91496221
O-methyl N-[[4-[4-[2-(3-aminophenyl)acetyl]piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate (PubChem CID 91496221) has the molecular formula C23H25F2N7O2S and a molecular weight of 501.56 g/mol. Its IUPAC name is O-methyl N-[[4-[4-[2-(3-aminophenyl)acetyl]piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate.
| Compound Name | O-methyl N-[[4-[4-[2-(3-aminophenyl)acetyl]piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 91496221 |
| Molecular Formula | C23H25F2N7O2S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | O-methyl N-[[4-[4-[2-(3-aminophenyl)acetyl]piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
| SMILES | COC(=S)NC(c1cc(F)c(N2CCN(C(=O)Cc3cccc(N)c3)CC2)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C23H25F2N7O2S/c1-34-23(35)28-21(19-13-27-30-29-19)15-11-17(24)22(18(25)12-15)32-7-5-31(6-8-32)20(33)10-14-3-2-4-16(26)9-14/h2-4,9,11-13,21H,5-8,10,26H2,1H3,(H,28,35)(H,27,29,30) |
| InChIKey | YPJIALRILAFYIC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|