C22H33F2N5O4 — CID 143999517
N-[3-[3,5-difluoro-N-formyl-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]anilino]-2-methoxypropyl]butanamide (PubChem CID 143999517) has the molecular formula C22H33F2N5O4 and a molecular weight of 469.53 g/mol. Its IUPAC name is N-[3-[3,5-difluoro-N-formyl-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]anilino]-2-methoxypropyl]butanamide.
| Compound Name | N-[3-[3,5-difluoro-N-formyl-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]anilino]-2-methoxypropyl]butanamide |
|---|---|
| PubChem CID | 143999517 |
| Molecular Formula | C22H33F2N5O4 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[3-[3,5-difluoro-N-formyl-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]anilino]-2-methoxypropyl]butanamide |
| SMILES | CCCC(=O)NCC(CN(C=O)c1cc(F)c(N2CCN(C(=O)CNC)CC2)c(F)c1)OC |
| InChI | InChI=1S/C22H33F2N5O4/c1-4-5-20(31)26-12-17(33-3)14-29(15-30)16-10-18(23)22(19(24)11-16)28-8-6-27(7-9-28)21(32)13-25-2/h10-11,15,17,25H,4-9,12-14H2,1-3H3,(H,26,31) |
| InChIKey | DETDUDMGXBLGJA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|