C14H17F2N3O2 — CID 119756685
1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-(methylamino)ethanone (PubChem CID 119756685) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-(methylamino)ethanone.
| Compound Name | 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 119756685 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)N1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-17-9-12(20)18-5-7-19(8-6-18)14(21)13-10(15)3-2-4-11(13)16/h2-4,17H,5-9H2,1H3 |
| InChIKey | FKJWNVQCHRISKY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |